C9H6F3NO4 — CID 108753851
4-hydroxy-3-[(2,2,2-trifluoroacetyl)amino]benzoic acid (PubChem CID 108753851) has the molecular formula C9H6F3NO4 and a molecular weight of 249.14 g/mol. Its IUPAC name is 4-hydroxy-3-[(2,2,2-trifluoroacetyl)amino]benzoic acid.
| Compound Name | 4-hydroxy-3-[(2,2,2-trifluoroacetyl)amino]benzoic acid |
|---|---|
| PubChem CID | 108753851 |
| Molecular Formula | C9H6F3NO4 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 4-hydroxy-3-[(2,2,2-trifluoroacetyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(O)c(NC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H6F3NO4/c10-9(11,12)8(17)13-5-3-4(7(15)16)1-2-6(5)14/h1-3,14H,(H,13,17)(H,15,16) |
| InChIKey | RZWJIPRNSPRHEL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|