C12H9N3O4 — CID 107264598
4-hydroxy-3-(pyrimidine-5-carbonylamino)benzoic acid (PubChem CID 107264598) has the molecular formula C12H9N3O4 and a molecular weight of 259.22 g/mol. Its IUPAC name is 4-hydroxy-3-(pyrimidine-5-carbonylamino)benzoic acid.
| Compound Name | 4-hydroxy-3-(pyrimidine-5-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 107264598 |
| Molecular Formula | C12H9N3O4 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 4-hydroxy-3-(pyrimidine-5-carbonylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(O)c(NC(=O)c2cncnc2)c1 |
| InChI | InChI=1S/C12H9N3O4/c16-10-2-1-7(12(18)19)3-9(10)15-11(17)8-4-13-6-14-5-8/h1-6,16H,(H,15,17)(H,18,19) |
| InChIKey | DHYWCVMSSJAKTK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|