C16H15NO6 — CID 108753869
3-[(3,5-dimethoxybenzoyl)amino]-4-hydroxybenzoic acid (PubChem CID 108753869) has the molecular formula C16H15NO6 and a molecular weight of 317.30 g/mol. Its IUPAC name is 3-[(3,5-dimethoxybenzoyl)amino]-4-hydroxybenzoic acid.
| Compound Name | 3-[(3,5-dimethoxybenzoyl)amino]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108753869 |
| Molecular Formula | C16H15NO6 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-[(3,5-dimethoxybenzoyl)amino]-4-hydroxybenzoic acid |
| SMILES | COc1cc(OC)cc(C(=O)Nc2cc(C(=O)O)ccc2O)c1 |
| InChI | InChI=1S/C16H15NO6/c1-22-11-5-10(6-12(8-11)23-2)15(19)17-13-7-9(16(20)21)3-4-14(13)18/h3-8,18H,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | WMFKXORHCWLJEK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|