C24H18N2O7 — CID 108753883
4-hydroxy-3-[[2-[(4-methoxyphenyl)methyl]-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid (PubChem CID 108753883) has the molecular formula C24H18N2O7 and a molecular weight of 446.42 g/mol. Its IUPAC name is 4-hydroxy-3-[[2-[(4-methoxyphenyl)methyl]-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid.
| Compound Name | 4-hydroxy-3-[[2-[(4-methoxyphenyl)methyl]-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108753883 |
| Molecular Formula | C24H18N2O7 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 4-hydroxy-3-[[2-[(4-methoxyphenyl)methyl]-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
| SMILES | COc1ccc(CN2C(=O)c3ccc(C(=O)Nc4cc(C(=O)O)ccc4O)cc3C2=O)cc1 |
| InChI | InChI=1S/C24H18N2O7/c1-33-16-6-2-13(3-7-16)12-26-22(29)17-8-4-14(10-18(17)23(26)30)21(28)25-19-11-15(24(31)32)5-9-20(19)27/h2-11,27H,12H2,1H3,(H,25,28)(H,31,32) |
| InChIKey | HTKQFZWBHKZFQR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|