C24H22N4O6 — CID 108761504
ethyl 5-[[2-[(4-methoxyphenyl)methyl]-1,3-dioxoisoindole-5-carbonyl]amino]-1-methylpyrazole-4-carboxylate (PubChem CID 108761504) has the molecular formula C24H22N4O6 and a molecular weight of 462.46 g/mol. Its IUPAC name is ethyl 5-[[2-[(4-methoxyphenyl)methyl]-1,3-dioxoisoindole-5-carbonyl]amino]-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[[2-[(4-methoxyphenyl)methyl]-1,3-dioxoisoindole-5-carbonyl]amino]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108761504 |
| Molecular Formula | C24H22N4O6 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | ethyl 5-[[2-[(4-methoxyphenyl)methyl]-1,3-dioxoisoindole-5-carbonyl]amino]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NC(=O)c1ccc2c(c1)C(=O)N(Cc1ccc(OC)cc1)C2=O |
| InChI | InChI=1S/C24H22N4O6/c1-4-34-24(32)19-12-25-27(2)20(19)26-21(29)15-7-10-17-18(11-15)23(31)28(22(17)30)13-14-5-8-16(33-3)9-6-14/h5-12H,4,13H2,1-3H3,(H,26,29) |
| InChIKey | UVMDNVCTVZZKTK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|