C27H21N3O4S — CID 108751315
2-[(4-methoxyphenyl)methyl]-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108751315) has the molecular formula C27H21N3O4S and a molecular weight of 483.55 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108751315 |
| Molecular Formula | C27H21N3O4S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | COc1ccc(CN2C(=O)c3ccc(C(=O)Nc4ccc(-c5csc(C)n5)cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C27H21N3O4S/c1-16-28-24(15-35-16)18-5-8-20(9-6-18)29-25(31)19-7-12-22-23(13-19)27(33)30(26(22)32)14-17-3-10-21(34-2)11-4-17/h3-13,15H,14H2,1-2H3,(H,29,31) |
| InChIKey | OLRMKGZHTKGZFI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|