C22H17N3O3 — CID 2664713
N-(4-methylphenyl)-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide (PubChem CID 2664713) has the molecular formula C22H17N3O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is N-(4-methylphenyl)-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-(4-methylphenyl)-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 2664713 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-(4-methylphenyl)-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc3c(c2)C(=O)N(Cc2ccncc2)C3=O)cc1 |
| InChI | InChI=1S/C22H17N3O3/c1-14-2-5-17(6-3-14)24-20(26)16-4-7-18-19(12-16)22(28)25(21(18)27)13-15-8-10-23-11-9-15/h2-12H,13H2,1H3,(H,24,26) |
| InChIKey | PKIJASLODDLAFY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|