C23H19N3O3 — CID 2596518
N-(2,5-dimethylphenyl)-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide (PubChem CID 2596518) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 2596518 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-(2,5-dimethylphenyl)-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2ccc3c(c2)C(=O)N(Cc2ccncc2)C3=O)c1 |
| InChI | InChI=1S/C23H19N3O3/c1-14-3-4-15(2)20(11-14)25-21(27)17-5-6-18-19(12-17)23(29)26(22(18)28)13-16-7-9-24-10-8-16/h3-12H,13H2,1-2H3,(H,25,27) |
| InChIKey | BATPRXLYRCIBOO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|