C22H16FN3O3 — CID 8869243
N-[(2-fluorophenyl)methyl]-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide (PubChem CID 8869243) has the molecular formula C22H16FN3O3 and a molecular weight of 389.39 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 8869243 |
| Molecular Formula | C22H16FN3O3 |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide |
| SMILES | O=C(NCc1ccccc1F)c1ccc2c(c1)C(=O)N(Cc1ccncc1)C2=O |
| InChI | InChI=1S/C22H16FN3O3/c23-19-4-2-1-3-16(19)12-25-20(27)15-5-6-17-18(11-15)22(29)26(21(17)28)13-14-7-9-24-10-8-14/h1-11H,12-13H2,(H,25,27) |
| InChIKey | FPTFNDDDIJWVGA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|