C24H21N3O3 — CID 78859866
2-benzyl-1,3-dioxo-N-(2,4,6-trimethyl-3-pyridinyl)isoindole-5-carboxamide (PubChem CID 78859866) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-benzyl-1,3-dioxo-N-(2,4,6-trimethyl-3-pyridinyl)isoindole-5-carboxamide.
| Compound Name | 2-benzyl-1,3-dioxo-N-(2,4,6-trimethyl-3-pyridinyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 78859866 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-benzyl-1,3-dioxo-N-(2,4,6-trimethyl-3-pyridinyl)isoindole-5-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2ccc3c(c2)C(=O)N(Cc2ccccc2)C3=O)c(C)n1 |
| InChI | InChI=1S/C24H21N3O3/c1-14-11-15(2)25-16(3)21(14)26-22(28)18-9-10-19-20(12-18)24(30)27(23(19)29)13-17-7-5-4-6-8-17/h4-12H,13H2,1-3H3,(H,26,28) |
| InChIKey | SWRBBIPIDVTCGA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|