C27H19N5O3S — CID 108751967
2-benzyl-N-[6-(4-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108751967) has the molecular formula C27H19N5O3S and a molecular weight of 493.55 g/mol. Its IUPAC name is 2-benzyl-N-[6-(4-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-benzyl-N-[6-(4-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108751967 |
| Molecular Formula | C27H19N5O3S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 2-benzyl-N-[6-(4-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1ccc(-c2csc3nc(NC(=O)c4ccc5c(c4)C(=O)N(Cc4ccccc4)C5=O)nn23)cc1 |
| InChI | InChI=1S/C27H19N5O3S/c1-16-7-9-18(10-8-16)22-15-36-27-29-26(30-32(22)27)28-23(33)19-11-12-20-21(13-19)25(35)31(24(20)34)14-17-5-3-2-4-6-17/h2-13,15H,14H2,1H3,(H,28,30,33) |
| InChIKey | FIRKDJARVXQAMC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|