C23H19N5O4S — CID 108751805
2-(3-methoxypropyl)-1,3-dioxo-N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)isoindole-5-carboxamide (PubChem CID 108751805) has the molecular formula C23H19N5O4S and a molecular weight of 461.50 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-1,3-dioxo-N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)isoindole-5-carboxamide.
| Compound Name | 2-(3-methoxypropyl)-1,3-dioxo-N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 108751805 |
| Molecular Formula | C23H19N5O4S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 2-(3-methoxypropyl)-1,3-dioxo-N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)isoindole-5-carboxamide |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)Nc3nc4scc(-c5ccccc5)n4n3)cc2C1=O |
| InChI | InChI=1S/C23H19N5O4S/c1-32-11-5-10-27-20(30)16-9-8-15(12-17(16)21(27)31)19(29)24-22-25-23-28(26-22)18(13-33-23)14-6-3-2-4-7-14/h2-4,6-9,12-13H,5,10-11H2,1H3,(H,24,26,29) |
| InChIKey | VMPWMVCRZZAFCO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|