C15H14N4O3 — CID 108738870
ethyl 5-[(3-cyanobenzoyl)amino]-1-methylpyrazole-4-carboxylate (PubChem CID 108738870) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is ethyl 5-[(3-cyanobenzoyl)amino]-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(3-cyanobenzoyl)amino]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108738870 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | ethyl 5-[(3-cyanobenzoyl)amino]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NC(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C15H14N4O3/c1-3-22-15(21)12-9-17-19(2)13(12)18-14(20)11-6-4-5-10(7-11)8-16/h4-7,9H,3H2,1-2H3,(H,18,20) |
| InChIKey | ZYRFEGQBJJHJCE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |