C10H12N4O3 — CID 110459593
ethyl 5-[(2-cyanoacetyl)amino]-1-methylpyrazole-4-carboxylate (PubChem CID 110459593) has the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. Its IUPAC name is ethyl 5-[(2-cyanoacetyl)amino]-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(2-cyanoacetyl)amino]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 110459593 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | ethyl 5-[(2-cyanoacetyl)amino]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NC(=O)CC#N |
| InChI | InChI=1S/C10H12N4O3/c1-3-17-10(16)7-6-12-14(2)9(7)13-8(15)4-5-11/h6H,3-4H2,1-2H3,(H,13,15) |
| InChIKey | SPEBFWZMJMSUBP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |