C14H14IN3O3 — CID 108761486
ethyl 5-[(2-iodobenzoyl)amino]-1-methylpyrazole-4-carboxylate (PubChem CID 108761486) has the molecular formula C14H14IN3O3 and a molecular weight of 399.19 g/mol. Its IUPAC name is ethyl 5-[(2-iodobenzoyl)amino]-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(2-iodobenzoyl)amino]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108761486 |
| Molecular Formula | C14H14IN3O3 |
| Molecular Weight | 399.19 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | ethyl 5-[(2-iodobenzoyl)amino]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NC(=O)c1ccccc1I |
| InChI | InChI=1S/C14H14IN3O3/c1-3-21-14(20)10-8-16-18(2)12(10)17-13(19)9-6-4-5-7-11(9)15/h4-8H,3H2,1-2H3,(H,17,19) |
| InChIKey | YFXBVXSIFANALG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|