C17H15N3O5 — CID 108738738
ethyl 1-methyl-5-[(2-oxochromene-3-carbonyl)amino]pyrazole-4-carboxylate (PubChem CID 108738738) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is ethyl 1-methyl-5-[(2-oxochromene-3-carbonyl)amino]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-methyl-5-[(2-oxochromene-3-carbonyl)amino]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108738738 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | ethyl 1-methyl-5-[(2-oxochromene-3-carbonyl)amino]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C17H15N3O5/c1-3-24-16(22)12-9-18-20(2)14(12)19-15(21)11-8-10-6-4-5-7-13(10)25-17(11)23/h4-9H,3H2,1-2H3,(H,19,21) |
| InChIKey | KBFVAPBXNNJEGC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|