C23H16FN3O6 — CID 16839626
ethyl 1-(4-fluorophenyl)-6-oxo-4-[(2-oxochromene-3-carbonyl)amino]pyridazine-3-carboxylate (PubChem CID 16839626) has the molecular formula C23H16FN3O6 and a molecular weight of 449.39 g/mol. Its IUPAC name is ethyl 1-(4-fluorophenyl)-6-oxo-4-[(2-oxochromene-3-carbonyl)amino]pyridazine-3-carboxylate.
| Compound Name | ethyl 1-(4-fluorophenyl)-6-oxo-4-[(2-oxochromene-3-carbonyl)amino]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 16839626 |
| Molecular Formula | C23H16FN3O6 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | ethyl 1-(4-fluorophenyl)-6-oxo-4-[(2-oxochromene-3-carbonyl)amino]pyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(F)cc2)c(=O)cc1NC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C23H16FN3O6/c1-2-32-23(31)20-17(12-19(28)27(26-20)15-9-7-14(24)8-10-15)25-21(29)16-11-13-5-3-4-6-18(13)33-22(16)30/h3-12H,2H2,1H3,(H,25,29) |
| InChIKey | CRXYDTDELUOVQC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|