C18H18FN3O6 — CID 16839570
5-[[3-ethoxycarbonyl-1-(4-fluorophenyl)-6-oxopyridazin-4-yl]amino]-5-oxopentanoic acid (PubChem CID 16839570) has the molecular formula C18H18FN3O6 and a molecular weight of 391.36 g/mol. Its IUPAC name is 5-[[3-ethoxycarbonyl-1-(4-fluorophenyl)-6-oxopyridazin-4-yl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[3-ethoxycarbonyl-1-(4-fluorophenyl)-6-oxopyridazin-4-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 16839570 |
| Molecular Formula | C18H18FN3O6 |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 5-[[3-ethoxycarbonyl-1-(4-fluorophenyl)-6-oxopyridazin-4-yl]amino]-5-oxopentanoic acid |
| SMILES | CCOC(=O)c1nn(-c2ccc(F)cc2)c(=O)cc1NC(=O)CCCC(=O)O |
| InChI | InChI=1S/C18H18FN3O6/c1-2-28-18(27)17-13(20-14(23)4-3-5-16(25)26)10-15(24)22(21-17)12-8-6-11(19)7-9-12/h6-10H,2-5H2,1H3,(H,20,23)(H,25,26) |
| InChIKey | AAWAZGBWGFBKJB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |