C14H13Cl2N3O3 — CID 108761476
ethyl 5-[(3,4-dichlorobenzoyl)amino]-1-methylpyrazole-4-carboxylate (PubChem CID 108761476) has the molecular formula C14H13Cl2N3O3 and a molecular weight of 342.18 g/mol. Its IUPAC name is ethyl 5-[(3,4-dichlorobenzoyl)amino]-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(3,4-dichlorobenzoyl)amino]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108761476 |
| Molecular Formula | C14H13Cl2N3O3 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | ethyl 5-[(3,4-dichlorobenzoyl)amino]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H13Cl2N3O3/c1-3-22-14(21)9-7-17-19(2)12(9)18-13(20)8-4-5-10(15)11(16)6-8/h4-7H,3H2,1-2H3,(H,18,20) |
| InChIKey | LWQFZJFNHKNNEK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |