C12H12BrN3O3S — CID 19585303
ethyl 5-[(4-bromothiophene-2-carbonyl)amino]-1-methylpyrazole-4-carboxylate (PubChem CID 19585303) has the molecular formula C12H12BrN3O3S and a molecular weight of 358.22 g/mol. Its IUPAC name is ethyl 5-[(4-bromothiophene-2-carbonyl)amino]-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(4-bromothiophene-2-carbonyl)amino]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 19585303 |
| Molecular Formula | C12H12BrN3O3S |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | ethyl 5-[(4-bromothiophene-2-carbonyl)amino]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NC(=O)c1cc(Br)cs1 |
| InChI | InChI=1S/C12H12BrN3O3S/c1-3-19-12(18)8-5-14-16(2)10(8)15-11(17)9-4-7(13)6-20-9/h4-6H,3H2,1-2H3,(H,15,17) |
| InChIKey | MOVRFUMQHQYDTD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |