C13H16ClN5O3 — CID 19263477
ethyl 5-[(4-chloro-1-ethylpyrazole-3-carbonyl)amino]-1-methylpyrazole-4-carboxylate (PubChem CID 19263477) has the molecular formula C13H16ClN5O3 and a molecular weight of 325.76 g/mol. Its IUPAC name is ethyl 5-[(4-chloro-1-ethylpyrazole-3-carbonyl)amino]-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(4-chloro-1-ethylpyrazole-3-carbonyl)amino]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 19263477 |
| Molecular Formula | C13H16ClN5O3 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | ethyl 5-[(4-chloro-1-ethylpyrazole-3-carbonyl)amino]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NC(=O)c1nn(CC)cc1Cl |
| InChI | InChI=1S/C13H16ClN5O3/c1-4-19-7-9(14)10(17-19)12(20)16-11-8(6-15-18(11)3)13(21)22-5-2/h6-7H,4-5H2,1-3H3,(H,16,20) |
| InChIKey | LXVKWPLDBUTILN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |