C16H18N4O4 — CID 108761488
ethyl 5-[(2-benzamidoacetyl)amino]-1-methylpyrazole-4-carboxylate (PubChem CID 108761488) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is ethyl 5-[(2-benzamidoacetyl)amino]-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(2-benzamidoacetyl)amino]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108761488 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | ethyl 5-[(2-benzamidoacetyl)amino]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NC(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18N4O4/c1-3-24-16(23)12-9-18-20(2)14(12)19-13(21)10-17-15(22)11-7-5-4-6-8-11/h4-9H,3,10H2,1-2H3,(H,17,22)(H,19,21) |
| InChIKey | COEGMYOPYIARFO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |