C24H27N3O4 — CID 69276968
2-[(4-methoxyphenyl)methyl]-1,3-dioxo-N-(3-pyrrolidin-1-ylpropyl)isoindole-5-carboxamide (PubChem CID 69276968) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-1,3-dioxo-N-(3-pyrrolidin-1-ylpropyl)isoindole-5-carboxamide.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-1,3-dioxo-N-(3-pyrrolidin-1-ylpropyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 69276968 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-1,3-dioxo-N-(3-pyrrolidin-1-ylpropyl)isoindole-5-carboxamide |
| SMILES | COc1ccc(CN2C(=O)c3ccc(C(=O)NCCCN4CCCC4)cc3C2=O)cc1 |
| InChI | InChI=1S/C24H27N3O4/c1-31-19-8-5-17(6-9-19)16-27-23(29)20-10-7-18(15-21(20)24(27)30)22(28)25-11-4-14-26-12-2-3-13-26/h5-10,15H,2-4,11-14,16H2,1H3,(H,25,28) |
| InChIKey | QTGVFBODVISBND-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|