C26H31N3O4 — CID 24782975
2-[(3-methoxyphenyl)methyl]-N-[3-(2-methylpiperidin-1-yl)propyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 24782975) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methyl]-N-[3-(2-methylpiperidin-1-yl)propyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-[(3-methoxyphenyl)methyl]-N-[3-(2-methylpiperidin-1-yl)propyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 24782975 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 2-[(3-methoxyphenyl)methyl]-N-[3-(2-methylpiperidin-1-yl)propyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | COc1cccc(CN2C(=O)c3ccc(C(=O)NCCCN4CCCCC4C)cc3C2=O)c1 |
| InChI | InChI=1S/C26H31N3O4/c1-18-7-3-4-13-28(18)14-6-12-27-24(30)20-10-11-22-23(16-20)26(32)29(25(22)31)17-19-8-5-9-21(15-19)33-2/h5,8-11,15-16,18H,3-4,6-7,12-14,17H2,1-2H3,(H,27,30) |
| InChIKey | HHCYCZRAIJHVJF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|