C21H32N6O2 — CID 47040948
3-(3-methoxyphenyl)-N-[3-(2-methylpiperidin-1-yl)propyl]-2-(5-methyltetrazol-1-yl)propanamide (PubChem CID 47040948) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-N-[3-(2-methylpiperidin-1-yl)propyl]-2-(5-methyltetrazol-1-yl)propanamide.
| Compound Name | 3-(3-methoxyphenyl)-N-[3-(2-methylpiperidin-1-yl)propyl]-2-(5-methyltetrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 47040948 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 3-(3-methoxyphenyl)-N-[3-(2-methylpiperidin-1-yl)propyl]-2-(5-methyltetrazol-1-yl)propanamide |
| SMILES | COc1cccc(CC(C(=O)NCCCN2CCCCC2C)n2nnnc2C)c1 |
| InChI | InChI=1S/C21H32N6O2/c1-16-8-4-5-12-26(16)13-7-11-22-21(28)20(27-17(2)23-24-25-27)15-18-9-6-10-19(14-18)29-3/h6,9-10,14,16,20H,4-5,7-8,11-13,15H2,1-3H3,(H,22,28) |
| InChIKey | PRLNSIINHHTVHG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|