C20H29FN6O — CID 119619312
N-[2-(cycloheptylamino)ethyl]-3-(4-fluorophenyl)-2-(5-methyltetrazol-1-yl)propanamide (PubChem CID 119619312) has the molecular formula C20H29FN6O and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-3-(4-fluorophenyl)-2-(5-methyltetrazol-1-yl)propanamide.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-3-(4-fluorophenyl)-2-(5-methyltetrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 119619312 |
| Molecular Formula | C20H29FN6O |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-3-(4-fluorophenyl)-2-(5-methyltetrazol-1-yl)propanamide |
| SMILES | Cc1nnnn1C(Cc1ccc(F)cc1)C(=O)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C20H29FN6O/c1-15-24-25-26-27(15)19(14-16-8-10-17(21)11-9-16)20(28)23-13-12-22-18-6-4-2-3-5-7-18/h8-11,18-19,22H,2-7,12-14H2,1H3,(H,23,28) |
| InChIKey | YMQMWJXOCDMMOO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|