C17H22FN5O2 — CID 111464206
3-(4-fluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]-2-(5-methyltetrazol-1-yl)propanamide (PubChem CID 111464206) has the molecular formula C17H22FN5O2 and a molecular weight of 347.39 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]-2-(5-methyltetrazol-1-yl)propanamide.
| Compound Name | 3-(4-fluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]-2-(5-methyltetrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 111464206 |
| Molecular Formula | C17H22FN5O2 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]-2-(5-methyltetrazol-1-yl)propanamide |
| SMILES | Cc1nnnn1C(Cc1ccc(F)cc1)C(=O)NCC1CCCC1O |
| InChI | InChI=1S/C17H22FN5O2/c1-11-20-21-22-23(11)15(9-12-5-7-14(18)8-6-12)17(25)19-10-13-3-2-4-16(13)24/h5-8,13,15-16,24H,2-4,9-10H2,1H3,(H,19,25) |
| InChIKey | PDKNSATUJFJDMK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |