C14H20ClFN6O — CID 119500200
3-(4-fluorophenyl)-N-[2-(methylamino)ethyl]-2-(5-methyltetrazol-1-yl)propanamide;hydrochloride (PubChem CID 119500200) has the molecular formula C14H20ClFN6O and a molecular weight of 342.81 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[2-(methylamino)ethyl]-2-(5-methyltetrazol-1-yl)propanamide;hydrochloride.
| Compound Name | 3-(4-fluorophenyl)-N-[2-(methylamino)ethyl]-2-(5-methyltetrazol-1-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119500200 |
| Molecular Formula | C14H20ClFN6O |
| Molecular Weight | 342.81 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[2-(methylamino)ethyl]-2-(5-methyltetrazol-1-yl)propanamide;hydrochloride |
| SMILES | CNCCNC(=O)C(Cc1ccc(F)cc1)n1nnnc1C.Cl |
| InChI | InChI=1S/C14H19FN6O.ClH/c1-10-18-19-20-21(10)13(14(22)17-8-7-16-2)9-11-3-5-12(15)6-4-11;/h3-6,13,16H,7-9H2,1-2H3,(H,17,22);1H |
| InChIKey | XJJBMVUWLNCZFB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.81 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|