C20H20FN5O3 — CID 119168903
4-[2-[[3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)propanoyl]amino]ethyl]benzoic acid (PubChem CID 119168903) has the molecular formula C20H20FN5O3 and a molecular weight of 397.41 g/mol. Its IUPAC name is 4-[2-[[3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)propanoyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[[3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)propanoyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 119168903 |
| Molecular Formula | C20H20FN5O3 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 4-[2-[[3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)propanoyl]amino]ethyl]benzoic acid |
| SMILES | Cc1nnnn1C(Cc1cccc(F)c1)C(=O)NCCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H20FN5O3/c1-13-23-24-25-26(13)18(12-15-3-2-4-17(21)11-15)19(27)22-10-9-14-5-7-16(8-6-14)20(28)29/h2-8,11,18H,9-10,12H2,1H3,(H,22,27)(H,28,29) |
| InChIKey | OIPIPNVTVGGPPX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |