C15H18FN5O3 — CID 119237695
3-[[3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)propanoyl]amino]-2-methylpropanoic acid (PubChem CID 119237695) has the molecular formula C15H18FN5O3 and a molecular weight of 335.34 g/mol. Its IUPAC name is 3-[[3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)propanoyl]amino]-2-methylpropanoic acid.
| Compound Name | 3-[[3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)propanoyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 119237695 |
| Molecular Formula | C15H18FN5O3 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 3-[[3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)propanoyl]amino]-2-methylpropanoic acid |
| SMILES | Cc1nnnn1C(Cc1cccc(F)c1)C(=O)NCC(C)C(=O)O |
| InChI | InChI=1S/C15H18FN5O3/c1-9(15(23)24)8-17-14(22)13(21-10(2)18-19-20-21)7-11-4-3-5-12(16)6-11/h3-6,9,13H,7-8H2,1-2H3,(H,17,22)(H,23,24) |
| InChIKey | XQOMEECRWSNHCV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |