C18H20FN7O — CID 166416460
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)propanamide (PubChem CID 166416460) has the molecular formula C18H20FN7O and a molecular weight of 369.40 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)propanamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 166416460 |
| Molecular Formula | C18H20FN7O |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)propanamide |
| SMILES | C#CCCC1(CCNC(=O)C(Cc2cccc(F)c2)n2nnnc2C)N=N1 |
| InChI | InChI=1S/C18H20FN7O/c1-3-4-8-18(22-23-18)9-10-20-17(27)16(26-13(2)21-24-25-26)12-14-6-5-7-15(19)11-14/h1,5-7,11,16H,4,8-10,12H2,2H3,(H,20,27) |
| InChIKey | ZFEBIVJYWLJPSB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|