C16H20FN5O2 — CID 51082128
3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)-N-(oxolan-3-ylmethyl)propanamide (PubChem CID 51082128) has the molecular formula C16H20FN5O2 and a molecular weight of 333.37 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)-N-(oxolan-3-ylmethyl)propanamide.
| Compound Name | 3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)-N-(oxolan-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 51082128 |
| Molecular Formula | C16H20FN5O2 |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)-N-(oxolan-3-ylmethyl)propanamide |
| SMILES | Cc1nnnn1C(Cc1cccc(F)c1)C(=O)NCC1CCOC1 |
| InChI | InChI=1S/C16H20FN5O2/c1-11-19-20-21-22(11)15(8-12-3-2-4-14(17)7-12)16(23)18-9-13-5-6-24-10-13/h2-4,7,13,15H,5-6,8-10H2,1H3,(H,18,23) |
| InChIKey | AHZGDQCKBWSEDB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |