C15H20FN5O2 — CID 110893922
N-ethyl-3-(3-fluorophenyl)-N-(2-hydroxyethyl)-2-(5-methyltetrazol-1-yl)propanamide (PubChem CID 110893922) has the molecular formula C15H20FN5O2 and a molecular weight of 321.36 g/mol. Its IUPAC name is N-ethyl-3-(3-fluorophenyl)-N-(2-hydroxyethyl)-2-(5-methyltetrazol-1-yl)propanamide.
| Compound Name | N-ethyl-3-(3-fluorophenyl)-N-(2-hydroxyethyl)-2-(5-methyltetrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 110893922 |
| Molecular Formula | C15H20FN5O2 |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | N-ethyl-3-(3-fluorophenyl)-N-(2-hydroxyethyl)-2-(5-methyltetrazol-1-yl)propanamide |
| SMILES | CCN(CCO)C(=O)C(Cc1cccc(F)c1)n1nnnc1C |
| InChI | InChI=1S/C15H20FN5O2/c1-3-20(7-8-22)15(23)14(21-11(2)17-18-19-21)10-12-5-4-6-13(16)9-12/h4-6,9,14,22H,3,7-8,10H2,1-2H3 |
| InChIKey | SWFOXLYHFSQHGU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |