C23H22FN5O — CID 166343594
1-[2-(4-ethynylphenyl)pyrrolidin-1-yl]-3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)propan-1-one (PubChem CID 166343594) has the molecular formula C23H22FN5O and a molecular weight of 403.46 g/mol. Its IUPAC name is 1-[2-(4-ethynylphenyl)pyrrolidin-1-yl]-3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)propan-1-one.
| Compound Name | 1-[2-(4-ethynylphenyl)pyrrolidin-1-yl]-3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 166343594 |
| Molecular Formula | C23H22FN5O |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 1-[2-(4-ethynylphenyl)pyrrolidin-1-yl]-3-(3-fluorophenyl)-2-(5-methyltetrazol-1-yl)propan-1-one |
| SMILES | C#Cc1ccc(C2CCCN2C(=O)C(Cc2cccc(F)c2)n2nnnc2C)cc1 |
| InChI | InChI=1S/C23H22FN5O/c1-3-17-9-11-19(12-10-17)21-8-5-13-28(21)23(30)22(29-16(2)25-26-27-29)15-18-6-4-7-20(24)14-18/h1,4,6-7,9-12,14,21-22H,5,8,13,15H2,2H3 |
| InChIKey | SIBFUDKNWZOXLC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|