C23H24FN3O3 — CID 69277947
2-[(3-fluorophenyl)methyl]-1,3-dioxo-N-(3-pyrrolidin-1-ylpropyl)isoindole-5-carboxamide (PubChem CID 69277947) has the molecular formula C23H24FN3O3 and a molecular weight of 409.46 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-1,3-dioxo-N-(3-pyrrolidin-1-ylpropyl)isoindole-5-carboxamide.
| Compound Name | 2-[(3-fluorophenyl)methyl]-1,3-dioxo-N-(3-pyrrolidin-1-ylpropyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 69277947 |
| Molecular Formula | C23H24FN3O3 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-1,3-dioxo-N-(3-pyrrolidin-1-ylpropyl)isoindole-5-carboxamide |
| SMILES | O=C(NCCCN1CCCC1)c1ccc2c(c1)C(=O)N(Cc1cccc(F)c1)C2=O |
| InChI | InChI=1S/C23H24FN3O3/c24-18-6-3-5-16(13-18)15-27-22(29)19-8-7-17(14-20(19)23(27)30)21(28)25-9-4-12-26-10-1-2-11-26/h3,5-8,13-14H,1-2,4,9-12,15H2,(H,25,28) |
| InChIKey | FITOOIUOEVSUAS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|