C24H28ClN3O3 — CID 24786050
2-[(3-methylphenyl)methyl]-1,3-dioxo-N-(2-piperidin-1-ylethyl)isoindole-5-carboxamide;hydrochloride (PubChem CID 24786050) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is 2-[(3-methylphenyl)methyl]-1,3-dioxo-N-(2-piperidin-1-ylethyl)isoindole-5-carboxamide;hydrochloride.
| Compound Name | 2-[(3-methylphenyl)methyl]-1,3-dioxo-N-(2-piperidin-1-ylethyl)isoindole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 24786050 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-[(3-methylphenyl)methyl]-1,3-dioxo-N-(2-piperidin-1-ylethyl)isoindole-5-carboxamide;hydrochloride |
| SMILES | Cc1cccc(CN2C(=O)c3ccc(C(=O)NCCN4CCCCC4)cc3C2=O)c1.Cl |
| InChI | InChI=1S/C24H27N3O3.ClH/c1-17-6-5-7-18(14-17)16-27-23(29)20-9-8-19(15-21(20)24(27)30)22(28)25-10-13-26-11-3-2-4-12-26;/h5-9,14-15H,2-4,10-13,16H2,1H3,(H,25,28);1H |
| InChIKey | RPGNUBTXSYKFBJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|