C23H25Cl2N3O4 — CID 24785779
2-[(3-chlorophenyl)methyl]-N-(3-morpholin-4-ylpropyl)-1,3-dioxoisoindole-5-carboxamide;hydrochloride (PubChem CID 24785779) has the molecular formula C23H25Cl2N3O4 and a molecular weight of 478.38 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-N-(3-morpholin-4-ylpropyl)-1,3-dioxoisoindole-5-carboxamide;hydrochloride.
| Compound Name | 2-[(3-chlorophenyl)methyl]-N-(3-morpholin-4-ylpropyl)-1,3-dioxoisoindole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 24785779 |
| Molecular Formula | C23H25Cl2N3O4 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-N-(3-morpholin-4-ylpropyl)-1,3-dioxoisoindole-5-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCN1CCOCC1)c1ccc2c(c1)C(=O)N(Cc1cccc(Cl)c1)C2=O |
| InChI | InChI=1S/C23H24ClN3O4.ClH/c24-18-4-1-3-16(13-18)15-27-22(29)19-6-5-17(14-20(19)23(27)30)21(28)25-7-2-8-26-9-11-31-12-10-26;/h1,3-6,13-14H,2,7-12,15H2,(H,25,28);1H |
| InChIKey | RNRITWUWFARANW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|