C9H7BrF3NO — CID 130674064
N-(2-bromo-5-fluorophenyl)-2,2-difluoropropanamide (PubChem CID 130674064) has the molecular formula C9H7BrF3NO and a molecular weight of 282.06 g/mol. Its IUPAC name is N-(2-bromo-5-fluorophenyl)-2,2-difluoropropanamide.
| Compound Name | N-(2-bromo-5-fluorophenyl)-2,2-difluoropropanamide |
|---|---|
| PubChem CID | 130674064 |
| Molecular Formula | C9H7BrF3NO |
| Molecular Weight | 282.06 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | N-(2-bromo-5-fluorophenyl)-2,2-difluoropropanamide |
| SMILES | CC(F)(F)C(=O)Nc1cc(F)ccc1Br |
| InChI | InChI=1S/C9H7BrF3NO/c1-9(12,13)8(15)14-7-4-5(11)2-3-6(7)10/h2-4H,1H3,(H,14,15) |
| InChIKey | NFRIMPIVPKBJDA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.06 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |