C9H10BrFN2O — CID 103755890
3-(2-bromo-5-fluorophenyl)-1,1-dimethylurea (PubChem CID 103755890) has the molecular formula C9H10BrFN2O and a molecular weight of 261.09 g/mol. Its IUPAC name is 3-(2-bromo-5-fluorophenyl)-1,1-dimethylurea.
| Compound Name | 3-(2-bromo-5-fluorophenyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 103755890 |
| Molecular Formula | C9H10BrFN2O |
| Molecular Weight | 261.09 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 3-(2-bromo-5-fluorophenyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1cc(F)ccc1Br |
| InChI | InChI=1S/C9H10BrFN2O/c1-13(2)9(14)12-8-5-6(11)3-4-7(8)10/h3-5H,1-2H3,(H,12,14) |
| InChIKey | FMLYRJGQHXVWJR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.09 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |