C9H10F2N2O — CID 110459919
3-(2,5-difluorophenyl)-1,1-dimethylurea (PubChem CID 110459919) has the molecular formula C9H10F2N2O and a molecular weight of 200.19 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)-1,1-dimethylurea.
| Compound Name | 3-(2,5-difluorophenyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 110459919 |
| Molecular Formula | C9H10F2N2O |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 3-(2,5-difluorophenyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C9H10F2N2O/c1-13(2)9(14)12-8-5-6(10)3-4-7(8)11/h3-5H,1-2H3,(H,12,14) |
| InChIKey | LVIMAFRFLSSDGN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |