C10H11FN4O — CID 110470406
3-(5-fluoro-1H-indazol-3-yl)-1,1-dimethylurea (PubChem CID 110470406) has the molecular formula C10H11FN4O and a molecular weight of 222.22 g/mol. Its IUPAC name is 3-(5-fluoro-1H-indazol-3-yl)-1,1-dimethylurea.
| Compound Name | 3-(5-fluoro-1H-indazol-3-yl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 110470406 |
| Molecular Formula | C10H11FN4O |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 3-(5-fluoro-1H-indazol-3-yl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1n[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C10H11FN4O/c1-15(2)10(16)12-9-7-5-6(11)3-4-8(7)13-14-9/h3-5H,1-2H3,(H2,12,13,14,16) |
| InChIKey | MKILACFTXGBWPJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |