C13H15FN4O — CID 110471863
N-(5-fluoro-1H-indazol-3-yl)piperidine-4-carboxamide (PubChem CID 110471863) has the molecular formula C13H15FN4O and a molecular weight of 262.29 g/mol. Its IUPAC name is N-(5-fluoro-1H-indazol-3-yl)piperidine-4-carboxamide.
| Compound Name | N-(5-fluoro-1H-indazol-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110471863 |
| Molecular Formula | C13H15FN4O |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | N-(5-fluoro-1H-indazol-3-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1n[nH]c2ccc(F)cc12)C1CCNCC1 |
| InChI | InChI=1S/C13H15FN4O/c14-9-1-2-11-10(7-9)12(18-17-11)16-13(19)8-3-5-15-6-4-8/h1-2,7-8,15H,3-6H2,(H2,16,17,18,19) |
| InChIKey | KGXASBKVHSAIBH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |