C9H8FN3O — CID 110469324
5-fluoro-N-methyl-1H-indazole-3-carboxamide (PubChem CID 110469324) has the molecular formula C9H8FN3O and a molecular weight of 193.18 g/mol. Its IUPAC name is 5-fluoro-N-methyl-1H-indazole-3-carboxamide.
| Compound Name | 5-fluoro-N-methyl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 110469324 |
| Molecular Formula | C9H8FN3O |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 5-fluoro-N-methyl-1H-indazole-3-carboxamide |
| SMILES | CNC(=O)c1n[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C9H8FN3O/c1-11-9(14)8-6-4-5(10)2-3-7(6)12-13-8/h2-4H,1H3,(H,11,14)(H,12,13) |
| InChIKey | YXGICJQWMOYODP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |