C12H14F2N2O2 — CID 44998522
N'-tert-butyl-N-(2,5-difluorophenyl)oxamide (PubChem CID 44998522) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is N'-tert-butyl-N-(2,5-difluorophenyl)oxamide.
| Compound Name | N'-tert-butyl-N-(2,5-difluorophenyl)oxamide |
|---|---|
| PubChem CID | 44998522 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N'-tert-butyl-N-(2,5-difluorophenyl)oxamide |
| SMILES | CC(C)(C)NC(=O)C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C12H14F2N2O2/c1-12(2,3)16-11(18)10(17)15-9-6-7(13)4-5-8(9)14/h4-6H,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | MCTSXUKPBYWFKZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|