C14H9F2IN2O2 — CID 108532053
N'-(2,5-difluorophenyl)-N-(4-iodophenyl)oxamide (PubChem CID 108532053) has the molecular formula C14H9F2IN2O2 and a molecular weight of 402.14 g/mol. Its IUPAC name is N'-(2,5-difluorophenyl)-N-(4-iodophenyl)oxamide.
| Compound Name | N'-(2,5-difluorophenyl)-N-(4-iodophenyl)oxamide |
|---|---|
| PubChem CID | 108532053 |
| Molecular Formula | C14H9F2IN2O2 |
| Molecular Weight | 402.14 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | N'-(2,5-difluorophenyl)-N-(4-iodophenyl)oxamide |
| SMILES | O=C(Nc1ccc(I)cc1)C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C14H9F2IN2O2/c15-8-1-6-11(16)12(7-8)19-14(21)13(20)18-10-4-2-9(17)3-5-10/h1-7H,(H,18,20)(H,19,21) |
| InChIKey | JNWMDBJXPPYSEC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.14 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|