C16H14F2N2O2 — CID 44998495
N'-(2,5-difluorophenyl)-N-(3,5-dimethylphenyl)oxamide (PubChem CID 44998495) has the molecular formula C16H14F2N2O2 and a molecular weight of 304.30 g/mol. Its IUPAC name is N'-(2,5-difluorophenyl)-N-(3,5-dimethylphenyl)oxamide.
| Compound Name | N'-(2,5-difluorophenyl)-N-(3,5-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 44998495 |
| Molecular Formula | C16H14F2N2O2 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N'-(2,5-difluorophenyl)-N-(3,5-dimethylphenyl)oxamide |
| SMILES | Cc1cc(C)cc(NC(=O)C(=O)Nc2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C16H14F2N2O2/c1-9-5-10(2)7-12(6-9)19-15(21)16(22)20-14-8-11(17)3-4-13(14)18/h3-8H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | VFAUPAMJUHYBMM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|