C12H11F2NO3 — CID 55169446
(Z)-4-(2,5-difluoroanilino)-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 55169446) has the molecular formula C12H11F2NO3 and a molecular weight of 255.22 g/mol. Its IUPAC name is (Z)-4-(2,5-difluoroanilino)-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-(2,5-difluoroanilino)-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 55169446 |
| Molecular Formula | C12H11F2NO3 |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | (Z)-4-(2,5-difluoroanilino)-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | C/C(C(=O)O)=C(\C)C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C12H11F2NO3/c1-6(7(2)12(17)18)11(16)15-10-5-8(13)3-4-9(10)14/h3-5H,1-2H3,(H,15,16)(H,17,18)/b7-6- |
| InChIKey | XLSCUEINJQVCNH-SREVYHEPSA-N |
| XLogP | 2.32 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|