C11H14ClFN2O — CID 78786317
1-tert-butyl-3-(5-chloro-2-fluorophenyl)urea (PubChem CID 78786317) has the molecular formula C11H14ClFN2O and a molecular weight of 244.70 g/mol. Its IUPAC name is 1-tert-butyl-3-(5-chloro-2-fluorophenyl)urea.
| Compound Name | 1-tert-butyl-3-(5-chloro-2-fluorophenyl)urea |
|---|---|
| PubChem CID | 78786317 |
| Molecular Formula | C11H14ClFN2O |
| Molecular Weight | 244.70 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-tert-butyl-3-(5-chloro-2-fluorophenyl)urea |
| SMILES | CC(C)(C)NC(=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C11H14ClFN2O/c1-11(2,3)15-10(16)14-9-6-7(12)4-5-8(9)13/h4-6H,1-3H3,(H2,14,15,16) |
| InChIKey | AAIKNYMOXRLYHO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.70 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |