C13H18Cl2N2O2 — CID 103916783
1-(2,5-dichlorophenyl)-3-(3-hydroxy-2,3-dimethylbutan-2-yl)urea (PubChem CID 103916783) has the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.20 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-(3-hydroxy-2,3-dimethylbutan-2-yl)urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-(3-hydroxy-2,3-dimethylbutan-2-yl)urea |
|---|---|
| PubChem CID | 103916783 |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-(3-hydroxy-2,3-dimethylbutan-2-yl)urea |
| SMILES | CC(C)(O)C(C)(C)NC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H18Cl2N2O2/c1-12(2,13(3,4)19)17-11(18)16-10-7-8(14)5-6-9(10)15/h5-7,19H,1-4H3,(H2,16,17,18) |
| InChIKey | LSPCPBNWZZSQKX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |