C9H8BrCl2NO — CID 94831435
(2S)-2-bromo-N-(2,5-dichlorophenyl)propanamide (PubChem CID 94831435) has the molecular formula C9H8BrCl2NO and a molecular weight of 296.98 g/mol. Its IUPAC name is (2S)-2-bromo-N-(2,5-dichlorophenyl)propanamide.
| Compound Name | (2S)-2-bromo-N-(2,5-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 94831435 |
| Molecular Formula | C9H8BrCl2NO |
| Molecular Weight | 296.98 g/mol |
| Exact Mass | 294.92 |
| IUPAC Name | (2S)-2-bromo-N-(2,5-dichlorophenyl)propanamide |
| SMILES | C[C@H](Br)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H8BrCl2NO/c1-5(10)9(14)13-8-4-6(11)2-3-7(8)12/h2-5H,1H3,(H,13,14)/t5-/m0/s1 |
| InChIKey | LCHCVEXHWWFVNH-YFKPBYRVSA-N |
| XLogP | 3.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.98 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|